C11H23NO — CID 143335324
ethane;4-methyl-2,5-dihydro-1H-pyridin-6-one;propane (PubChem CID 143335324) has the molecular formula C11H23NO and a molecular weight of 185.31 g/mol. Its IUPAC name is ethane;4-methyl-2,5-dihydro-1H-pyridin-6-one;propane.
| Compound Name | ethane;4-methyl-2,5-dihydro-1H-pyridin-6-one;propane |
|---|---|
| PubChem CID | 143335324 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | ethane;4-methyl-2,5-dihydro-1H-pyridin-6-one;propane |
| SMILES | CC.CC1=CCNC(=O)C1.CCC |
| InChI | InChI=1S/C6H9NO.C3H8.C2H6/c1-5-2-3-7-6(8)4-5;1-3-2;1-2/h2H,3-4H2,1H3,(H,7,8);3H2,1-2H3;1-2H3 |
| InChIKey | PHVPVBQHTSQREM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|