C9H13NO — CID 145486862
(3Z,5Z)-5-methyl-1,2,7,8-tetrahydroazonin-9-one (PubChem CID 145486862) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is (3Z,5Z)-5-methyl-1,2,7,8-tetrahydroazonin-9-one.
| Compound Name | (3Z,5Z)-5-methyl-1,2,7,8-tetrahydroazonin-9-one |
|---|---|
| PubChem CID | 145486862 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | (3Z,5Z)-5-methyl-1,2,7,8-tetrahydroazonin-9-one |
| SMILES | CC1=C/CCC(=O)NC/C=C\1 |
| InChI | InChI=1S/C9H13NO/c1-8-4-2-6-9(11)10-7-3-5-8/h3-5H,2,6-7H2,1H3,(H,10,11)/b5-3-,8-4- |
| InChIKey | BLLKAYBNYONMDW-ZWWVTPAXSA-N |
| XLogP | 1.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |