C17H33NO2 — CID 142103663
ethane;N-[3-(4-methylcyclohexa-2,4-dien-1-yl)oxypropyl]propanamide (PubChem CID 142103663) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is ethane;N-[3-(4-methylcyclohexa-2,4-dien-1-yl)oxypropyl]propanamide.
| Compound Name | ethane;N-[3-(4-methylcyclohexa-2,4-dien-1-yl)oxypropyl]propanamide |
|---|---|
| PubChem CID | 142103663 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | ethane;N-[3-(4-methylcyclohexa-2,4-dien-1-yl)oxypropyl]propanamide |
| SMILES | CC.CC.CCC(=O)NCCCOC1C=CC(C)=CC1 |
| InChI | InChI=1S/C13H21NO2.2C2H6/c1-3-13(15)14-9-4-10-16-12-7-5-11(2)6-8-12;2*1-2/h5-7,12H,3-4,8-10H2,1-2H3,(H,14,15);2*1-2H3 |
| InChIKey | HMSMDFQYWIFADI-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|