C15H27NO — CID 143093704
(3S)-3-(2-cyclohexa-1,3-dien-1-yloxyethyl)piperidine;ethane (PubChem CID 143093704) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (3S)-3-(2-cyclohexa-1,3-dien-1-yloxyethyl)piperidine;ethane.
| Compound Name | (3S)-3-(2-cyclohexa-1,3-dien-1-yloxyethyl)piperidine;ethane |
|---|---|
| PubChem CID | 143093704 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (3S)-3-(2-cyclohexa-1,3-dien-1-yloxyethyl)piperidine;ethane |
| SMILES | C1=CCCC(OCC[C@@H]2CCCNC2)=C1.CC |
| InChI | InChI=1S/C13H21NO.C2H6/c1-2-6-13(7-3-1)15-10-8-12-5-4-9-14-11-12;1-2/h1-2,6,12,14H,3-5,7-11H2;1-2H3/t12-;/m0./s1 |
| InChIKey | XFIQYNGFZPOOFG-YDALLXLXSA-N |
| XLogP | 3.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |