C20H23N2O3+ — CID 143094564
(Z)-methoxy-[(3-methoxycarbonyl-1,2-dihydroquinolin-4-yl)methylidene]azanium;toluene (PubChem CID 143094564) has the molecular formula C20H23N2O3+ and a molecular weight of 339.42 g/mol. Its IUPAC name is (Z)-methoxy-[(3-methoxycarbonyl-1,2-dihydroquinolin-4-yl)methylidene]azanium;toluene.
| Compound Name | (Z)-methoxy-[(3-methoxycarbonyl-1,2-dihydroquinolin-4-yl)methylidene]azanium;toluene |
|---|---|
| PubChem CID | 143094564 |
| Molecular Formula | C20H23N2O3+ |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (Z)-methoxy-[(3-methoxycarbonyl-1,2-dihydroquinolin-4-yl)methylidene]azanium;toluene |
| SMILES | CO/[NH+]=C\C1=C(C(=O)OC)CNc2ccccc21.Cc1ccccc1 |
| InChI | InChI=1S/C13H14N2O3.C7H8/c1-17-13(16)11-7-14-12-6-4-3-5-9(12)10(11)8-15-18-2;1-7-5-3-2-4-6-7/h3-6,8,14H,7H2,1-2H3;2-6H,1H3/p+1/b15-8-; |
| InChIKey | HYBNZVBSGJHPCF-ZTXYIFKNSA-O |
| XLogP | 1.75 |
| TPSA | 61.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|