C10H17NO — CID 143095314
1-(4-methyl-2,3-dihydropyrrol-1-yl)ethanone;prop-1-ene (PubChem CID 143095314) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 1-(4-methyl-2,3-dihydropyrrol-1-yl)ethanone;prop-1-ene.
| Compound Name | 1-(4-methyl-2,3-dihydropyrrol-1-yl)ethanone;prop-1-ene |
|---|---|
| PubChem CID | 143095314 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 1-(4-methyl-2,3-dihydropyrrol-1-yl)ethanone;prop-1-ene |
| SMILES | C=CC.CC(=O)N1C=C(C)CC1 |
| InChI | InChI=1S/C7H11NO.C3H6/c1-6-3-4-8(5-6)7(2)9;1-3-2/h5H,3-4H2,1-2H3;3H,1H2,2H3 |
| InChIKey | OOIWZBAUENLXOB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|