C22H31NO2 — CID 143095938
(2S)-2-[(1S,2E,4Z)-1-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]oxy-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]morpholine (PubChem CID 143095938) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (2S)-2-[(1S,2E,4Z)-1-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]oxy-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]morpholine.
| Compound Name | (2S)-2-[(1S,2E,4Z)-1-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]oxy-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]morpholine |
|---|---|
| PubChem CID | 143095938 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (2S)-2-[(1S,2E,4Z)-1-[(3E,5Z,7Z)-nona-1,3,5,7-tetraen-4-yl]oxy-2-[(Z)-prop-1-enyl]hexa-2,4-dienyl]morpholine |
| SMILES | C=C/C=C(\C=C/C=C\C)O[C@@H](C(/C=C\C)=C/C=C\C)[C@@H]1CNCCO1 |
| InChI | InChI=1S/C22H31NO2/c1-5-9-11-15-20(13-8-4)25-22(21-18-23-16-17-24-21)19(12-7-3)14-10-6-2/h5-15,21-23H,4,16-18H2,1-3H3/b9-5-,10-6-,12-7-,15-11-,19-14+,20-13+/t21-,22-/m0/s1 |
| InChIKey | RBQODVWQSOVIFI-DGIWYJISSA-N |
| XLogP | 4.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|