C16H27N3 — CID 143097013
(3Z)-3-methylpenta-1,3-diene-1,1-diamine;2-methyl-4-propylaniline (PubChem CID 143097013) has the molecular formula C16H27N3 and a molecular weight of 261.41 g/mol. Its IUPAC name is (3Z)-3-methylpenta-1,3-diene-1,1-diamine;2-methyl-4-propylaniline.
| Compound Name | (3Z)-3-methylpenta-1,3-diene-1,1-diamine;2-methyl-4-propylaniline |
|---|---|
| PubChem CID | 143097013 |
| Molecular Formula | C16H27N3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | (3Z)-3-methylpenta-1,3-diene-1,1-diamine;2-methyl-4-propylaniline |
| SMILES | C/C=C(/C)C=C(N)N.CCCc1ccc(N)c(C)c1 |
| InChI | InChI=1S/C10H15N.C6H12N2/c1-3-4-9-5-6-10(11)8(2)7-9;1-3-5(2)4-6(7)8/h5-7H,3-4,11H2,1-2H3;3-4H,7-8H2,1-2H3/b;5-3- |
| InChIKey | PSMAMKVYAKVIHA-PJAIOPLOSA-N |
| XLogP | 3.24 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|