C29H49N11 — CID 143099731
N,N'-diamino-2-[4-(dipropylamino)butyl-[[4-[[1H-imidazol-2-ylmethyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]phenyl]methyl]amino]ethanimidamide (PubChem CID 143099731) has the molecular formula C29H49N11 and a molecular weight of 551.79 g/mol. Its IUPAC name is N,N'-diamino-2-[4-(dipropylamino)butyl-[[4-[[1H-imidazol-2-ylmethyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]phenyl]methyl]amino]ethanimidamide.
| Compound Name | N,N'-diamino-2-[4-(dipropylamino)butyl-[[4-[[1H-imidazol-2-ylmethyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]phenyl]methyl]amino]ethanimidamide |
|---|---|
| PubChem CID | 143099731 |
| Molecular Formula | C29H49N11 |
| Molecular Weight | 551.79 g/mol |
| Exact Mass | 551.42 |
| IUPAC Name | N,N'-diamino-2-[4-(dipropylamino)butyl-[[4-[[1H-imidazol-2-ylmethyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]phenyl]methyl]amino]ethanimidamide |
| SMILES | CCCN(CCC)CCCCN(C/C(=N/N)NN)Cc1ccc(CN(Cc2ncc[nH]2)Cc2nccn2C)cc1 |
| InChI | InChI=1S/C29H49N11/c1-4-15-38(16-5-2)17-6-7-18-39(23-28(35-30)36-31)20-25-8-10-26(11-9-25)21-40(22-27-32-12-13-33-27)24-29-34-14-19-37(29)3/h8-14,19H,4-7,15-18,20-24,30-31H2,1-3H3,(H,32,33)(H,35,36) |
| InChIKey | CXEUCGQUJNYRDU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 132.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.79 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|