C28H41N7O — CID 91338811
2-[4-(dipropylamino)butyl]-5-[[1H-imidazol-2-ylmethyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]isoindol-1-ol (PubChem CID 91338811) has the molecular formula C28H41N7O and a molecular weight of 491.68 g/mol. Its IUPAC name is 2-[4-(dipropylamino)butyl]-5-[[1H-imidazol-2-ylmethyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]isoindol-1-ol.
| Compound Name | 2-[4-(dipropylamino)butyl]-5-[[1H-imidazol-2-ylmethyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]isoindol-1-ol |
|---|---|
| PubChem CID | 91338811 |
| Molecular Formula | C28H41N7O |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | 2-[4-(dipropylamino)butyl]-5-[[1H-imidazol-2-ylmethyl-[(1-methylimidazol-2-yl)methyl]amino]methyl]isoindol-1-ol |
| SMILES | CCCN(CCC)CCCCn1cc2cc(CN(Cc3ncc[nH]3)Cc3nccn3C)ccc2c1O |
| InChI | InChI=1S/C28H41N7O/c1-4-13-33(14-5-2)15-6-7-16-35-20-24-18-23(8-9-25(24)28(35)36)19-34(21-26-29-10-11-30-26)22-27-31-12-17-32(27)3/h8-12,17-18,20,36H,4-7,13-16,19,21-22H2,1-3H3,(H,29,30) |
| InChIKey | PMFNOZQEEFHCKQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 78.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|