About 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione
2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione (PubChem CID 143100003) has the molecular formula C10H12N4S2
and a molecular weight of 252.37 g/mol. Its IUPAC name is 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione.
Molecular Properties
| Compound Name | 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione |
| PubChem CID | 143100003 |
| Molecular Formula | C10H12N4S2 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione |
| SMILES | Cc1ccnc(=S)[nH]1.Cc1nccc(=S)[nH]1 |
| InChI | InChI=1S/2C5H6N2S/c1-4-6-3-2-5(8)7-4;1-4-2-3-6-5(8)7-4/h2*2-3H,1H3,(H,6,7,8) |
| InChIKey | GYVVUCGEKZCTIL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione?
The IUPAC name of 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione (CID 143100003) is 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione.
What is the SMILES notation for 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione?
The canonical SMILES for 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione is Cc1ccnc(=S)[nH]1.Cc1nccc(=S)[nH]1.
What is the InChIKey of 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione?
The InChIKey is GYVVUCGEKZCTIL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H6N2S/c1-4-6-3-2-5(8)7-4;1-4-2-3-6-5(8)7-4/h2*2-3H,1H3,(H,6,7,8).
What are the key properties of 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione?
2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione has a molecular weight of 252.37 g/mol, XLogP of 2.90, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1H-pyrimidine-6-thione;6-methyl-1H-pyrimidine-2-thione is sourced from PubChem (CID 143100003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).