C9H8N4S2 — CID 91488835
6-methyl-2-(2-sulfanylidene-1H-pyrimidin-6-yl)-1H-pyrimidine-4-thione (PubChem CID 91488835) has the molecular formula C9H8N4S2 and a molecular weight of 236.33 g/mol. Its IUPAC name is 6-methyl-2-(2-sulfanylidene-1H-pyrimidin-6-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-methyl-2-(2-sulfanylidene-1H-pyrimidin-6-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 91488835 |
| Molecular Formula | C9H8N4S2 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 6-methyl-2-(2-sulfanylidene-1H-pyrimidin-6-yl)-1H-pyrimidine-4-thione |
| SMILES | Cc1cc(=S)nc(-c2ccnc(=S)[nH]2)[nH]1 |
| InChI | InChI=1S/C9H8N4S2/c1-5-4-7(14)13-8(11-5)6-2-3-10-9(15)12-6/h2-4H,1H3,(H,10,12,15)(H,11,13,14) |
| InChIKey | NYWDYVJFQLCCFC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|