C12H16N6S2 — CID 15784292
6-methyl-4-[2-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]ethylamino]-1H-pyrimidine-2-thione (PubChem CID 15784292) has the molecular formula C12H16N6S2 and a molecular weight of 308.44 g/mol. Its IUPAC name is 6-methyl-4-[2-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]ethylamino]-1H-pyrimidine-2-thione.
| Compound Name | 6-methyl-4-[2-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]ethylamino]-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 15784292 |
| Molecular Formula | C12H16N6S2 |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 6-methyl-4-[2-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]ethylamino]-1H-pyrimidine-2-thione |
| SMILES | Cc1cc(NCCNc2cc(C)[nH]c(=S)n2)nc(=S)[nH]1 |
| InChI | InChI=1S/C12H16N6S2/c1-7-5-9(17-11(19)15-7)13-3-4-14-10-6-8(2)16-12(20)18-10/h5-6H,3-4H2,1-2H3,(H2,13,15,17,19)(H2,14,16,18,20) |
| InChIKey | MTMDBRRMGPJERA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|