C10H17N4S+ — CID 2322591
6-methyl-4-(4-methylpiperazin-4-ium-1-yl)-1H-pyrimidine-2-thione (PubChem CID 2322591) has the molecular formula C10H17N4S+ and a molecular weight of 225.34 g/mol. Its IUPAC name is 6-methyl-4-(4-methylpiperazin-4-ium-1-yl)-1H-pyrimidine-2-thione.
| Compound Name | 6-methyl-4-(4-methylpiperazin-4-ium-1-yl)-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 2322591 |
| Molecular Formula | C10H17N4S+ |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 6-methyl-4-(4-methylpiperazin-4-ium-1-yl)-1H-pyrimidine-2-thione |
| SMILES | Cc1cc(N2CC[NH+](C)CC2)nc(=S)[nH]1 |
| InChI | InChI=1S/C10H16N4S/c1-8-7-9(12-10(15)11-8)14-5-3-13(2)4-6-14/h7H,3-6H2,1-2H3,(H,11,12,15)/p+1 |
| InChIKey | KJGKPCDBISZDKP-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|