C13H18N6S2 — CID 15784280
6-methyl-4-[3-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]propylamino]-1H-pyrimidine-2-thione (PubChem CID 15784280) has the molecular formula C13H18N6S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is 6-methyl-4-[3-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]propylamino]-1H-pyrimidine-2-thione.
| Compound Name | 6-methyl-4-[3-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]propylamino]-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 15784280 |
| Molecular Formula | C13H18N6S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 6-methyl-4-[3-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]propylamino]-1H-pyrimidine-2-thione |
| SMILES | Cc1cc(NCCCNc2cc(C)[nH]c(=S)n2)nc(=S)[nH]1 |
| InChI | InChI=1S/C13H18N6S2/c1-8-6-10(18-12(20)16-8)14-4-3-5-15-11-7-9(2)17-13(21)19-11/h6-7H,3-5H2,1-2H3,(H2,14,16,18,20)(H2,15,17,19,21) |
| InChIKey | BGXFWSNBVQJRMR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|