C17H26N6S2 — CID 53491180
6-methyl-4-[7-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]heptylamino]-1H-pyrimidine-2-thione (PubChem CID 53491180) has the molecular formula C17H26N6S2 and a molecular weight of 378.57 g/mol. Its IUPAC name is 6-methyl-4-[7-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]heptylamino]-1H-pyrimidine-2-thione.
| Compound Name | 6-methyl-4-[7-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]heptylamino]-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 53491180 |
| Molecular Formula | C17H26N6S2 |
| Molecular Weight | 378.57 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 6-methyl-4-[7-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]heptylamino]-1H-pyrimidine-2-thione |
| SMILES | Cc1cc(NCCCCCCCNc2cc(C)[nH]c(=S)n2)nc(=S)[nH]1 |
| InChI | InChI=1S/C17H26N6S2/c1-12-10-14(22-16(24)20-12)18-8-6-4-3-5-7-9-19-15-11-13(2)21-17(25)23-15/h10-11H,3-9H2,1-2H3,(H2,18,20,22,24)(H2,19,21,23,25) |
| InChIKey | GNZBRGPWYAANAH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|