C18H28N6S2 — CID 53491184
6-methyl-4-[8-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]octylamino]-1H-pyrimidine-2-thione (PubChem CID 53491184) has the molecular formula C18H28N6S2 and a molecular weight of 392.60 g/mol. Its IUPAC name is 6-methyl-4-[8-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]octylamino]-1H-pyrimidine-2-thione.
| Compound Name | 6-methyl-4-[8-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]octylamino]-1H-pyrimidine-2-thione |
|---|---|
| PubChem CID | 53491184 |
| Molecular Formula | C18H28N6S2 |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 6-methyl-4-[8-[(6-methyl-2-sulfanylidene-1H-pyrimidin-4-yl)amino]octylamino]-1H-pyrimidine-2-thione |
| SMILES | Cc1cc(NCCCCCCCCNc2cc(C)[nH]c(=S)n2)nc(=S)[nH]1 |
| InChI | InChI=1S/C18H28N6S2/c1-13-11-15(23-17(25)21-13)19-9-7-5-3-4-6-8-10-20-16-12-14(2)22-18(26)24-16/h11-12H,3-10H2,1-2H3,(H2,19,21,23,25)(H2,20,22,24,26) |
| InChIKey | YCGSFAWIKFNQQP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|