C21H25F2N3O — CID 143100018
4-[(Z)-1-amino-2-(4-fluoroanilino)prop-1-enyl]-2-[[2-fluoropropyl(methyl)amino]methyl]benzaldehyde (PubChem CID 143100018) has the molecular formula C21H25F2N3O and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-[(Z)-1-amino-2-(4-fluoroanilino)prop-1-enyl]-2-[[2-fluoropropyl(methyl)amino]methyl]benzaldehyde.
| Compound Name | 4-[(Z)-1-amino-2-(4-fluoroanilino)prop-1-enyl]-2-[[2-fluoropropyl(methyl)amino]methyl]benzaldehyde |
|---|---|
| PubChem CID | 143100018 |
| Molecular Formula | C21H25F2N3O |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[(Z)-1-amino-2-(4-fluoroanilino)prop-1-enyl]-2-[[2-fluoropropyl(methyl)amino]methyl]benzaldehyde |
| SMILES | C/C(Nc1ccc(F)cc1)=C(/N)c1ccc(C=O)c(CN(C)CC(C)F)c1 |
| InChI | InChI=1S/C21H25F2N3O/c1-14(22)11-26(3)12-18-10-16(4-5-17(18)13-27)21(24)15(2)25-20-8-6-19(23)7-9-20/h4-10,13-14,25H,11-12,24H2,1-3H3/b21-15- |
| InChIKey | PPFBSHDCODGMCA-QNGOZBTKSA-N |
| XLogP | 4.19 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|