About 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol
2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol (PubChem CID 172605306) has the molecular formula C15H22F3NO2
and a molecular weight of 305.34 g/mol. Its IUPAC name is 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol.
Molecular Properties
| Compound Name | 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol |
| PubChem CID | 172605306 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol |
| SMILES | CCC(C)N(C)CCc1cc(F)ccc1C=O.OC(F)F |
| InChI | InChI=1S/C14H20FNO.CH2F2O/c1-4-11(2)16(3)8-7-12-9-14(15)6-5-13(12)10-17;2-1(3)4/h5-6,9-11H,4,7-8H2,1-3H3;1,4H |
| InChIKey | JPDCWPJTWQFERH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol?
The IUPAC name of 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol (CID 172605306) is 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol.
What is the SMILES notation for 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol?
The canonical SMILES for 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol is CCC(C)N(C)CCc1cc(F)ccc1C=O.OC(F)F.
What is the InChIKey of 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol?
The InChIKey is JPDCWPJTWQFERH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO.CH2F2O/c1-4-11(2)16(3)8-7-12-9-14(15)6-5-13(12)10-17;2-1(3)4/h5-6,9-11H,4,7-8H2,1-3H3;1,4H.
What are the key properties of 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol?
2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol has a molecular weight of 305.34 g/mol, XLogP of 3.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[butan-2-yl(methyl)amino]ethyl]-4-fluorobenzaldehyde;difluoromethanol is sourced from PubChem (CID 172605306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).