C18H25FN2 — CID 146410333
3-N-[2-(2-ethenyl-5-fluorophenyl)ethyl]-2-N,3-N-dimethylhexa-1,5-diene-2,3-diamine (PubChem CID 146410333) has the molecular formula C18H25FN2 and a molecular weight of 288.41 g/mol. Its IUPAC name is 3-N-[2-(2-ethenyl-5-fluorophenyl)ethyl]-2-N,3-N-dimethylhexa-1,5-diene-2,3-diamine.
| Compound Name | 3-N-[2-(2-ethenyl-5-fluorophenyl)ethyl]-2-N,3-N-dimethylhexa-1,5-diene-2,3-diamine |
|---|---|
| PubChem CID | 146410333 |
| Molecular Formula | C18H25FN2 |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 3-N-[2-(2-ethenyl-5-fluorophenyl)ethyl]-2-N,3-N-dimethylhexa-1,5-diene-2,3-diamine |
| SMILES | C=CCC(C(=C)NC)N(C)CCc1cc(F)ccc1C=C |
| InChI | InChI=1S/C18H25FN2/c1-6-8-18(14(3)20-4)21(5)12-11-16-13-17(19)10-9-15(16)7-2/h6-7,9-10,13,18,20H,1-3,8,11-12H2,4-5H3 |
| InChIKey | JSAQBEPTXFKEJP-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|