C25H41N3O — CID 174198783
2-[[2-ethenyl-5-[7-(methylamino)heptyl]phenyl]methyl-methylamino]-N-methylhex-5-enamide (PubChem CID 174198783) has the molecular formula C25H41N3O and a molecular weight of 399.62 g/mol. Its IUPAC name is 2-[[2-ethenyl-5-[7-(methylamino)heptyl]phenyl]methyl-methylamino]-N-methylhex-5-enamide.
| Compound Name | 2-[[2-ethenyl-5-[7-(methylamino)heptyl]phenyl]methyl-methylamino]-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 174198783 |
| Molecular Formula | C25H41N3O |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.32 |
| IUPAC Name | 2-[[2-ethenyl-5-[7-(methylamino)heptyl]phenyl]methyl-methylamino]-N-methylhex-5-enamide |
| SMILES | C=CCCC(C(=O)NC)N(C)Cc1cc(CCCCCCCNC)ccc1C=C |
| InChI | InChI=1S/C25H41N3O/c1-6-8-15-24(25(29)27-4)28(5)20-23-19-21(16-17-22(23)7-2)14-12-10-9-11-13-18-26-3/h6-7,16-17,19,24,26H,1-2,8-15,18,20H2,3-5H3,(H,27,29) |
| InChIKey | UZBPJQUYHFBGHO-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|