C30H43N5O — CID 167257499
2-[[2-ethenyl-5-[1-[[2-(2-iminoethyl)-1,2-dihydropyridin-3-yl]methyl]piperidin-4-yl]phenyl]methyl-methylamino]-N-methylhex-5-enamide (PubChem CID 167257499) has the molecular formula C30H43N5O and a molecular weight of 489.71 g/mol. Its IUPAC name is 2-[[2-ethenyl-5-[1-[[2-(2-iminoethyl)-1,2-dihydropyridin-3-yl]methyl]piperidin-4-yl]phenyl]methyl-methylamino]-N-methylhex-5-enamide.
| Compound Name | 2-[[2-ethenyl-5-[1-[[2-(2-iminoethyl)-1,2-dihydropyridin-3-yl]methyl]piperidin-4-yl]phenyl]methyl-methylamino]-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 167257499 |
| Molecular Formula | C30H43N5O |
| Molecular Weight | 489.71 g/mol |
| Exact Mass | 489.35 |
| IUPAC Name | 2-[[2-ethenyl-5-[1-[[2-(2-iminoethyl)-1,2-dihydropyridin-3-yl]methyl]piperidin-4-yl]phenyl]methyl-methylamino]-N-methylhex-5-enamide |
| SMILES | [H]/N=C/CC1NC=CC=C1CN1CCC(c2ccc(C=C)c(CN(C)C(CCC=C)C(=O)NC)c2)CC1 |
| InChI | InChI=1S/C30H43N5O/c1-5-7-10-29(30(36)32-3)34(4)21-27-20-25(12-11-23(27)6-2)24-14-18-35(19-15-24)22-26-9-8-17-33-28(26)13-16-31/h5-6,8-9,11-12,16-17,20,24,28-29,31,33H,1-2,7,10,13-15,18-19,21-22H2,3-4H3,(H,32,36)/b31-16+ |
| InChIKey | XONOASWYSIREBF-WCMJOSRZSA-N |
| XLogP | 4.47 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|