C29H34FN3O — CID 167257706
5-[[4-[4-ethenyl-3-[[methyl(6-oxohex-1-en-3-yl)amino]methyl]phenyl]piperidin-1-yl]methyl]-2-fluorobenzonitrile (PubChem CID 167257706) has the molecular formula C29H34FN3O and a molecular weight of 459.61 g/mol. Its IUPAC name is 5-[[4-[4-ethenyl-3-[[methyl(6-oxohex-1-en-3-yl)amino]methyl]phenyl]piperidin-1-yl]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[4-[4-ethenyl-3-[[methyl(6-oxohex-1-en-3-yl)amino]methyl]phenyl]piperidin-1-yl]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 167257706 |
| Molecular Formula | C29H34FN3O |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | 5-[[4-[4-ethenyl-3-[[methyl(6-oxohex-1-en-3-yl)amino]methyl]phenyl]piperidin-1-yl]methyl]-2-fluorobenzonitrile |
| SMILES | C=Cc1ccc(C2CCN(Cc3ccc(F)c(C#N)c3)CC2)cc1CN(C)C(C=C)CCC=O |
| InChI | InChI=1S/C29H34FN3O/c1-4-23-9-10-25(18-27(23)21-32(3)28(5-2)7-6-16-34)24-12-14-33(15-13-24)20-22-8-11-29(30)26(17-22)19-31/h4-5,8-11,16-18,24,28H,1-2,6-7,12-15,20-21H2,3H3 |
| InChIKey | IPHHTXVASKDZOE-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|