C27H44N4O — CID 170071284
2-[[2-ethenyl-5-[[2-(2-methylpropylamino)cyclohexyl]amino]phenyl]methyl-methylamino]-N-methylhex-5-enamide (PubChem CID 170071284) has the molecular formula C27H44N4O and a molecular weight of 440.68 g/mol. Its IUPAC name is 2-[[2-ethenyl-5-[[2-(2-methylpropylamino)cyclohexyl]amino]phenyl]methyl-methylamino]-N-methylhex-5-enamide.
| Compound Name | 2-[[2-ethenyl-5-[[2-(2-methylpropylamino)cyclohexyl]amino]phenyl]methyl-methylamino]-N-methylhex-5-enamide |
|---|---|
| PubChem CID | 170071284 |
| Molecular Formula | C27H44N4O |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | 2-[[2-ethenyl-5-[[2-(2-methylpropylamino)cyclohexyl]amino]phenyl]methyl-methylamino]-N-methylhex-5-enamide |
| SMILES | C=CCCC(C(=O)NC)N(C)Cc1cc(NC2CCCCC2NCC(C)C)ccc1C=C |
| InChI | InChI=1S/C27H44N4O/c1-7-9-14-26(27(32)28-5)31(6)19-22-17-23(16-15-21(22)8-2)30-25-13-11-10-12-24(25)29-18-20(3)4/h7-8,15-17,20,24-26,29-30H,1-2,9-14,18-19H2,3-6H3,(H,28,32) |
| InChIKey | USKVSTHNIUWNRS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|