C10H13NO2 — CID 143100399
1-[(1S,2S,5R)-3-acetyl-3-azabicyclo[3.2.0]hept-6-en-2-yl]ethanone (PubChem CID 143100399) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-[(1S,2S,5R)-3-acetyl-3-azabicyclo[3.2.0]hept-6-en-2-yl]ethanone.
| Compound Name | 1-[(1S,2S,5R)-3-acetyl-3-azabicyclo[3.2.0]hept-6-en-2-yl]ethanone |
|---|---|
| PubChem CID | 143100399 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-[(1S,2S,5R)-3-acetyl-3-azabicyclo[3.2.0]hept-6-en-2-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@H]2C=C[C@H]2CN1C(C)=O |
| InChI | InChI=1S/C10H13NO2/c1-6(12)10-9-4-3-8(9)5-11(10)7(2)13/h3-4,8-10H,5H2,1-2H3/t8-,9-,10+/m0/s1 |
| InChIKey | QPJWYDDBIQDFPC-LPEHRKFASA-N |
| XLogP | 0.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|