C12H17NO3 — CID 20647194
1-[2-[(E)-pent-3-enoyl]pyrrolidin-1-yl]propane-1,2-dione (PubChem CID 20647194) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-[2-[(E)-pent-3-enoyl]pyrrolidin-1-yl]propane-1,2-dione.
| Compound Name | 1-[2-[(E)-pent-3-enoyl]pyrrolidin-1-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 20647194 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-[2-[(E)-pent-3-enoyl]pyrrolidin-1-yl]propane-1,2-dione |
| SMILES | C/C=C/CC(=O)C1CCCN1C(=O)C(C)=O |
| InChI | InChI=1S/C12H17NO3/c1-3-4-7-11(15)10-6-5-8-13(10)12(16)9(2)14/h3-4,10H,5-8H2,1-2H3/b4-3+ |
| InChIKey | IZBJYWRYVUYJPS-ONEGZZNKSA-N |
| XLogP | 1.10 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|