C14H23N5 — CID 143101112
4-[2-[[(Z)-2-amino-4-(methylamino)but-1-enyl]amino]ethyl]benzenecarboximidamide (PubChem CID 143101112) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-[2-[[(Z)-2-amino-4-(methylamino)but-1-enyl]amino]ethyl]benzenecarboximidamide.
| Compound Name | 4-[2-[[(Z)-2-amino-4-(methylamino)but-1-enyl]amino]ethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 143101112 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 4-[2-[[(Z)-2-amino-4-(methylamino)but-1-enyl]amino]ethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CCN/C=C(\N)CCNC)cc1 |
| InChI | InChI=1S/C14H23N5/c1-18-8-7-13(15)10-19-9-6-11-2-4-12(5-3-11)14(16)17/h2-5,10,18-19H,6-9,15H2,1H3,(H3,16,17)/b13-10- |
| InChIKey | TTWQTBOFEPEDIX-RAXLEYEMSA-N |
| XLogP | 0.51 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|