C21H38N6 — CID 144860197
methanimidamide;4-[(Z)-5-[7-(methylamino)heptylamino]pent-1-enyl]benzenecarboximidamide (PubChem CID 144860197) has the molecular formula C21H38N6 and a molecular weight of 374.58 g/mol. Its IUPAC name is methanimidamide;4-[(Z)-5-[7-(methylamino)heptylamino]pent-1-enyl]benzenecarboximidamide.
| Compound Name | methanimidamide;4-[(Z)-5-[7-(methylamino)heptylamino]pent-1-enyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 144860197 |
| Molecular Formula | C21H38N6 |
| Molecular Weight | 374.58 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | methanimidamide;4-[(Z)-5-[7-(methylamino)heptylamino]pent-1-enyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(/C=C\CCCNCCCCCCCNC)cc1.[H]/N=C/N |
| InChI | InChI=1S/C20H34N4.CH4N2/c1-23-15-7-3-2-4-8-16-24-17-9-5-6-10-18-11-13-19(14-12-18)20(21)22;2-1-3/h6,10-14,23-24H,2-5,7-9,15-17H2,1H3,(H3,21,22);1H,(H3,2,3)/b10-6-; |
| InChIKey | LINGKVXTYHFMPI-OTUCAILMSA-N |
| XLogP | 3.08 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|