C9H18O — CID 143101140
(2S,4S)-2,4-dimethyloxane;ethene (PubChem CID 143101140) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is (2S,4S)-2,4-dimethyloxane;ethene.
| Compound Name | (2S,4S)-2,4-dimethyloxane;ethene |
|---|---|
| PubChem CID | 143101140 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | (2S,4S)-2,4-dimethyloxane;ethene |
| SMILES | C=C.C[C@H]1CCO[C@@H](C)C1 |
| InChI | InChI=1S/C7H14O.C2H4/c1-6-3-4-8-7(2)5-6;1-2/h6-7H,3-5H2,1-2H3;1-2H2/t6-,7-;/m0./s1 |
| InChIKey | GUIYYPZWGZHBQL-LEUCUCNGSA-N |
| XLogP | 2.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|