C17H19N3O — CID 143103238
2-[4-cyano-N-(cyclopropylmethyl)-3-ethynylanilino]-N-ethylacetamide (PubChem CID 143103238) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-[4-cyano-N-(cyclopropylmethyl)-3-ethynylanilino]-N-ethylacetamide.
| Compound Name | 2-[4-cyano-N-(cyclopropylmethyl)-3-ethynylanilino]-N-ethylacetamide |
|---|---|
| PubChem CID | 143103238 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-[4-cyano-N-(cyclopropylmethyl)-3-ethynylanilino]-N-ethylacetamide |
| SMILES | C#Cc1cc(N(CC(=O)NCC)CC2CC2)ccc1C#N |
| InChI | InChI=1S/C17H19N3O/c1-3-14-9-16(8-7-15(14)10-18)20(11-13-5-6-13)12-17(21)19-4-2/h1,7-9,13H,4-6,11-12H2,2H3,(H,19,21) |
| InChIKey | GKUWMYLEDSFBFQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|