C17H20F3N3O — CID 68582483
N-[4-cyano-3-(trifluoromethyl)phenyl]-N-(cyclopropylmethyl)-2-(propylamino)acetamide (PubChem CID 68582483) has the molecular formula C17H20F3N3O and a molecular weight of 339.36 g/mol. Its IUPAC name is N-[4-cyano-3-(trifluoromethyl)phenyl]-N-(cyclopropylmethyl)-2-(propylamino)acetamide.
| Compound Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-N-(cyclopropylmethyl)-2-(propylamino)acetamide |
|---|---|
| PubChem CID | 68582483 |
| Molecular Formula | C17H20F3N3O |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[4-cyano-3-(trifluoromethyl)phenyl]-N-(cyclopropylmethyl)-2-(propylamino)acetamide |
| SMILES | CCCNCC(=O)N(CC1CC1)c1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F3N3O/c1-2-7-22-10-16(24)23(11-12-3-4-12)14-6-5-13(9-21)15(8-14)17(18,19)20/h5-6,8,12,22H,2-4,7,10-11H2,1H3 |
| InChIKey | ZBTHQDBKRPXABT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|