C9H14IN3O2 — CID 143103394
N-(1λ3,2-iodoxiran-1-yl)-N-[6-(propylamino)-3-pyridinyl]hydroxylamine (PubChem CID 143103394) has the molecular formula C9H14IN3O2 and a molecular weight of 323.13 g/mol. Its IUPAC name is N-(1λ3,2-iodoxiran-1-yl)-N-[6-(propylamino)-3-pyridinyl]hydroxylamine.
| Compound Name | N-(1λ3,2-iodoxiran-1-yl)-N-[6-(propylamino)-3-pyridinyl]hydroxylamine |
|---|---|
| PubChem CID | 143103394 |
| Molecular Formula | C9H14IN3O2 |
| Molecular Weight | 323.13 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-(1λ3,2-iodoxiran-1-yl)-N-[6-(propylamino)-3-pyridinyl]hydroxylamine |
| SMILES | CCCNc1ccc(N(O)I2CO2)cn1 |
| InChI | InChI=1S/C9H14IN3O2/c1-2-5-11-9-4-3-8(6-12-9)13(14)10-7-15-10/h3-4,6,14H,2,5,7H2,1H3,(H,11,12) |
| InChIKey | PYROTPPCMFNYLJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.13 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|