C12H17N3 — CID 102540088
5-(3,4-dihydro-2H-pyrrol-5-yl)-N-propylpyridin-2-amine (PubChem CID 102540088) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-pyrrol-5-yl)-N-propylpyridin-2-amine.
| Compound Name | 5-(3,4-dihydro-2H-pyrrol-5-yl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 102540088 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 5-(3,4-dihydro-2H-pyrrol-5-yl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1ccc(C2=NCCC2)cn1 |
| InChI | InChI=1S/C12H17N3/c1-2-7-14-12-6-5-10(9-15-12)11-4-3-8-13-11/h5-6,9H,2-4,7-8H2,1H3,(H,14,15) |
| InChIKey | TVEJSVYURJOVEK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |