C13H17N — CID 151560856
6-(4-ethylphenyl)-2,3,4,5-tetrahydropyridine (PubChem CID 151560856) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 6-(4-ethylphenyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-(4-ethylphenyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 151560856 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 6-(4-ethylphenyl)-2,3,4,5-tetrahydropyridine |
| SMILES | CCc1ccc(C2=NCCCC2)cc1 |
| InChI | InChI=1S/C13H17N/c1-2-11-6-8-12(9-7-11)13-5-3-4-10-14-13/h6-9H,2-5,10H2,1H3 |
| InChIKey | QCKSWPVDBTVXIY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |