C13H19N3 — CID 102540216
N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine (PubChem CID 102540216) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine.
| Compound Name | N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 102540216 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine |
| SMILES | CCC(C)Nc1ccc(C2=NCCC2)cn1 |
| InChI | InChI=1S/C13H19N3/c1-3-10(2)16-13-7-6-11(9-15-13)12-5-4-8-14-12/h6-7,9-10H,3-5,8H2,1-2H3,(H,15,16) |
| InChIKey | LZHOCPNCBRFPIV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |