About N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine
N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine (PubChem CID 102540216) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine |
| PubChem CID | 102540216 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine |
| SMILES | CCC(C)Nc1ccc(C2=NCCC2)cn1 |
| InChI | InChI=1S/C13H19N3/c1-3-10(2)16-13-7-6-11(9-15-13)12-5-4-8-14-12/h6-7,9-10H,3-5,8H2,1-2H3,(H,15,16) |
| InChIKey | LZHOCPNCBRFPIV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine?
The IUPAC name of N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine (CID 102540216) is N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine.
What is the SMILES notation for N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine?
The canonical SMILES for N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine is CCC(C)Nc1ccc(C2=NCCC2)cn1.
What is the InChIKey of N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine?
The InChIKey is LZHOCPNCBRFPIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-3-10(2)16-13-7-6-11(9-15-13)12-5-4-8-14-12/h6-7,9-10H,3-5,8H2,1-2H3,(H,15,16).
What are the key properties of N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine?
N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine has a molecular weight of 217.32 g/mol, XLogP of 2.87, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-5-(3,4-dihydro-2H-pyrrol-5-yl)pyridin-2-amine is sourced from PubChem (CID 102540216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).