C12H18FN3 — CID 61474336
5-fluoro-N-(1-pyrrolidin-1-ylpropan-2-yl)pyridin-2-amine (PubChem CID 61474336) has the molecular formula C12H18FN3 and a molecular weight of 223.30 g/mol. Its IUPAC name is 5-fluoro-N-(1-pyrrolidin-1-ylpropan-2-yl)pyridin-2-amine.
| Compound Name | 5-fluoro-N-(1-pyrrolidin-1-ylpropan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 61474336 |
| Molecular Formula | C12H18FN3 |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.15 |
| IUPAC Name | 5-fluoro-N-(1-pyrrolidin-1-ylpropan-2-yl)pyridin-2-amine |
| SMILES | CC(CN1CCCC1)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C12H18FN3/c1-10(9-16-6-2-3-7-16)15-12-5-4-11(13)8-14-12/h4-5,8,10H,2-3,6-7,9H2,1H3,(H,14,15) |
| InChIKey | PBCMYYSEBYTIMR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |