C16H26FN5O — CID 99595837
1-[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-3-(5-fluoro-2-pyridinyl)urea (PubChem CID 99595837) has the molecular formula C16H26FN5O and a molecular weight of 323.42 g/mol. Its IUPAC name is 1-[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-3-(5-fluoro-2-pyridinyl)urea.
| Compound Name | 1-[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-3-(5-fluoro-2-pyridinyl)urea |
|---|---|
| PubChem CID | 99595837 |
| Molecular Formula | C16H26FN5O |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 1-[(2S)-3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-3-(5-fluoro-2-pyridinyl)urea |
| SMILES | CCN1CCN(C[C@@H](C)CNC(=O)Nc2ccc(F)cn2)CC1 |
| InChI | InChI=1S/C16H26FN5O/c1-3-21-6-8-22(9-7-21)12-13(2)10-19-16(23)20-15-5-4-14(17)11-18-15/h4-5,11,13H,3,6-10,12H2,1-2H3,(H2,18,19,20,23)/t13-/m0/s1 |
| InChIKey | QWRGPTLAVSJHHR-ZDUSSCGKSA-N |
| XLogP | 1.62 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |