C9H16N4 — CID 55282176
N-butan-2-yl-5-hydrazinylpyridin-2-amine (PubChem CID 55282176) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is N-butan-2-yl-5-hydrazinylpyridin-2-amine.
| Compound Name | N-butan-2-yl-5-hydrazinylpyridin-2-amine |
|---|---|
| PubChem CID | 55282176 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | N-butan-2-yl-5-hydrazinylpyridin-2-amine |
| SMILES | CCC(C)Nc1ccc(NN)cn1 |
| InChI | InChI=1S/C9H16N4/c1-3-7(2)12-9-5-4-8(13-10)6-11-9/h4-7,13H,3,10H2,1-2H3,(H,11,12) |
| InChIKey | MHZUUYZFZCMLSU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|