C11H11NO2 — CID 130170876
3-(4-ethylphenyl)-4H-1,2-oxazol-5-one (PubChem CID 130170876) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-4H-1,2-oxazol-5-one.
| Compound Name | 3-(4-ethylphenyl)-4H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 130170876 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 3-(4-ethylphenyl)-4H-1,2-oxazol-5-one |
| SMILES | CCc1ccc(C2=NOC(=O)C2)cc1 |
| InChI | InChI=1S/C11H11NO2/c1-2-8-3-5-9(6-4-8)10-7-11(13)14-12-10/h3-6H,2,7H2,1H3 |
| InChIKey | CURMIAJSBCKXTG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|