C12H12F2N2 — CID 169107092
3-(difluoromethyl)-5-(4-ethylphenyl)-4H-pyrazole (PubChem CID 169107092) has the molecular formula C12H12F2N2 and a molecular weight of 222.24 g/mol. Its IUPAC name is 3-(difluoromethyl)-5-(4-ethylphenyl)-4H-pyrazole.
| Compound Name | 3-(difluoromethyl)-5-(4-ethylphenyl)-4H-pyrazole |
|---|---|
| PubChem CID | 169107092 |
| Molecular Formula | C12H12F2N2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 3-(difluoromethyl)-5-(4-ethylphenyl)-4H-pyrazole |
| SMILES | CCc1ccc(C2=NN=C(C(F)F)C2)cc1 |
| InChI | InChI=1S/C12H12F2N2/c1-2-8-3-5-9(6-4-8)10-7-11(12(13)14)16-15-10/h3-6,12H,2,7H2,1H3 |
| InChIKey | JGZGFCCYXJYDHO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |