C26H33F3N4S — CID 145239001
N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-N-[3-(3-fluoropyrrolidin-1-yl)propylsulfanyl]aniline;ethane (PubChem CID 145239001) has the molecular formula C26H33F3N4S and a molecular weight of 490.64 g/mol. Its IUPAC name is N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-N-[3-(3-fluoropyrrolidin-1-yl)propylsulfanyl]aniline;ethane.
| Compound Name | N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-N-[3-(3-fluoropyrrolidin-1-yl)propylsulfanyl]aniline;ethane |
|---|---|
| PubChem CID | 145239001 |
| Molecular Formula | C26H33F3N4S |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-N-[3-(3-fluoropyrrolidin-1-yl)propylsulfanyl]aniline;ethane |
| SMILES | CC.FC1CCN(CCCSN(Cc2ccc(C3=NN=C(C(F)F)C3)cc2)c2ccccc2)C1 |
| InChI | InChI=1S/C24H27F3N4S.C2H6/c25-20-11-13-30(17-20)12-4-14-32-31(21-5-2-1-3-6-21)16-18-7-9-19(10-8-18)22-15-23(24(26)27)29-28-22;1-2/h1-3,5-10,20,24H,4,11-17H2;1-2H3 |
| InChIKey | VHERZSPHLCTBPW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|