C21H21F2N5S — CID 145238390
N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-1-ethyl-N-methylsulfanylindazol-6-amine (PubChem CID 145238390) has the molecular formula C21H21F2N5S and a molecular weight of 413.50 g/mol. Its IUPAC name is N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-1-ethyl-N-methylsulfanylindazol-6-amine.
| Compound Name | N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-1-ethyl-N-methylsulfanylindazol-6-amine |
|---|---|
| PubChem CID | 145238390 |
| Molecular Formula | C21H21F2N5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | N-[[4-[5-(difluoromethyl)-4H-pyrazol-3-yl]phenyl]methyl]-1-ethyl-N-methylsulfanylindazol-6-amine |
| SMILES | CCn1ncc2ccc(N(Cc3ccc(C4=NN=C(C(F)F)C4)cc3)SC)cc21 |
| InChI | InChI=1S/C21H21F2N5S/c1-3-27-20-10-17(9-8-16(20)12-24-27)28(29-2)13-14-4-6-15(7-5-14)18-11-19(21(22)23)26-25-18/h4-10,12,21H,3,11,13H2,1-2H3 |
| InChIKey | JUGBELDWHLQSGG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 45.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|