C21H29N5OS — CID 145238783
ethane;4-[[methylsulfanyl-(1-propan-2-ylindazol-6-yl)amino]methyl]benzohydrazide (PubChem CID 145238783) has the molecular formula C21H29N5OS and a molecular weight of 399.56 g/mol. Its IUPAC name is ethane;4-[[methylsulfanyl-(1-propan-2-ylindazol-6-yl)amino]methyl]benzohydrazide.
| Compound Name | ethane;4-[[methylsulfanyl-(1-propan-2-ylindazol-6-yl)amino]methyl]benzohydrazide |
|---|---|
| PubChem CID | 145238783 |
| Molecular Formula | C21H29N5OS |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | ethane;4-[[methylsulfanyl-(1-propan-2-ylindazol-6-yl)amino]methyl]benzohydrazide |
| SMILES | CC.CSN(Cc1ccc(C(=O)NN)cc1)c1ccc2cnn(C(C)C)c2c1 |
| InChI | InChI=1S/C19H23N5OS.C2H6/c1-13(2)24-18-10-17(9-8-16(18)11-21-24)23(26-3)12-14-4-6-15(7-5-14)19(25)22-20;1-2/h4-11,13H,12,20H2,1-3H3,(H,22,25);1-2H3 |
| InChIKey | BBBCFTXLBCKHPO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|