C22H30N4S2 — CID 145238720
ethane;N-[[4-(1-hydrazinylethenyl)phenyl]methyl]-N-methylsulfanyl-2-propan-2-yl-1,3-benzothiazol-6-amine (PubChem CID 145238720) has the molecular formula C22H30N4S2 and a molecular weight of 414.64 g/mol. Its IUPAC name is ethane;N-[[4-(1-hydrazinylethenyl)phenyl]methyl]-N-methylsulfanyl-2-propan-2-yl-1,3-benzothiazol-6-amine.
| Compound Name | ethane;N-[[4-(1-hydrazinylethenyl)phenyl]methyl]-N-methylsulfanyl-2-propan-2-yl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 145238720 |
| Molecular Formula | C22H30N4S2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | ethane;N-[[4-(1-hydrazinylethenyl)phenyl]methyl]-N-methylsulfanyl-2-propan-2-yl-1,3-benzothiazol-6-amine |
| SMILES | C=C(NN)c1ccc(CN(SC)c2ccc3nc(C(C)C)sc3c2)cc1.CC |
| InChI | InChI=1S/C20H24N4S2.C2H6/c1-13(2)20-22-18-10-9-17(11-19(18)26-20)24(25-4)12-15-5-7-16(8-6-15)14(3)23-21;1-2/h5-11,13,23H,3,12,21H2,1-2,4H3;1-2H3 |
| InChIKey | OKTAADFGKKHUHY-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|