C16H22N2S — CID 117438981
1-(2-propan-2-yl-1,3-benzothiazol-6-yl)cyclohexan-1-amine (PubChem CID 117438981) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-(2-propan-2-yl-1,3-benzothiazol-6-yl)cyclohexan-1-amine.
| Compound Name | 1-(2-propan-2-yl-1,3-benzothiazol-6-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 117438981 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 1-(2-propan-2-yl-1,3-benzothiazol-6-yl)cyclohexan-1-amine |
| SMILES | CC(C)c1nc2ccc(C3(N)CCCCC3)cc2s1 |
| InChI | InChI=1S/C16H22N2S/c1-11(2)15-18-13-7-6-12(10-14(13)19-15)16(17)8-4-3-5-9-16/h6-7,10-11H,3-5,8-9,17H2,1-2H3 |
| InChIKey | LOAJBGDIHIQLTA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |