C18H26N2S — CID 117487447
[1-(2-tert-butyl-1,3-benzothiazol-6-yl)cyclohexyl]methanamine (PubChem CID 117487447) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is [1-(2-tert-butyl-1,3-benzothiazol-6-yl)cyclohexyl]methanamine.
| Compound Name | [1-(2-tert-butyl-1,3-benzothiazol-6-yl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 117487447 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | [1-(2-tert-butyl-1,3-benzothiazol-6-yl)cyclohexyl]methanamine |
| SMILES | CC(C)(C)c1nc2ccc(C3(CN)CCCCC3)cc2s1 |
| InChI | InChI=1S/C18H26N2S/c1-17(2,3)16-20-14-8-7-13(11-15(14)21-16)18(12-19)9-5-4-6-10-18/h7-8,11H,4-6,9-10,12,19H2,1-3H3 |
| InChIKey | PWRKRVRSIXWEBZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |