C23H28ClF2N5S — CID 145238681
3-chloro-N-[[5-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-pyridinyl]methyl]-N-piperidin-4-ylsulfanylaniline;ethane (PubChem CID 145238681) has the molecular formula C23H28ClF2N5S and a molecular weight of 480.03 g/mol. Its IUPAC name is 3-chloro-N-[[5-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-pyridinyl]methyl]-N-piperidin-4-ylsulfanylaniline;ethane.
| Compound Name | 3-chloro-N-[[5-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-pyridinyl]methyl]-N-piperidin-4-ylsulfanylaniline;ethane |
|---|---|
| PubChem CID | 145238681 |
| Molecular Formula | C23H28ClF2N5S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 3-chloro-N-[[5-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-pyridinyl]methyl]-N-piperidin-4-ylsulfanylaniline;ethane |
| SMILES | CC.FC(F)C1=NN=C(c2ccc(CN(SC3CCNCC3)c3cccc(Cl)c3)nc2)C1 |
| InChI | InChI=1S/C21H22ClF2N5S.C2H6/c22-15-2-1-3-17(10-15)29(30-18-6-8-25-9-7-18)13-16-5-4-14(12-26-16)19-11-20(21(23)24)28-27-19;1-2/h1-5,10,12,18,21,25H,6-9,11,13H2;1-2H3 |
| InChIKey | BERSZVXPVIUTSZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|