C21H23F2N5OS — CID 145239175
N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-(1-methylpiperidin-4-yl)sulfanylaniline (PubChem CID 145239175) has the molecular formula C21H23F2N5OS and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-(1-methylpiperidin-4-yl)sulfanylaniline.
| Compound Name | N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-(1-methylpiperidin-4-yl)sulfanylaniline |
|---|---|
| PubChem CID | 145239175 |
| Molecular Formula | C21H23F2N5OS |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-(1-methylpiperidin-4-yl)sulfanylaniline |
| SMILES | CN1CCC(SN(Cc2ccc(-c3nnc(C(F)F)o3)cn2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H23F2N5OS/c1-27-11-9-18(10-12-27)30-28(17-5-3-2-4-6-17)14-16-8-7-15(13-24-16)20-25-26-21(29-20)19(22)23/h2-8,13,18-19H,9-12,14H2,1H3 |
| InChIKey | OJAACLLQOXXUHG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 58.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|