C19H18F2N4O2S — CID 145238557
N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-(oxolan-3-ylsulfanyl)aniline (PubChem CID 145238557) has the molecular formula C19H18F2N4O2S and a molecular weight of 404.44 g/mol. Its IUPAC name is N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-(oxolan-3-ylsulfanyl)aniline.
| Compound Name | N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-(oxolan-3-ylsulfanyl)aniline |
|---|---|
| PubChem CID | 145238557 |
| Molecular Formula | C19H18F2N4O2S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methyl]-N-(oxolan-3-ylsulfanyl)aniline |
| SMILES | FC(F)c1nnc(-c2ccc(CN(SC3CCOC3)c3ccccc3)nc2)o1 |
| InChI | InChI=1S/C19H18F2N4O2S/c20-17(21)19-24-23-18(27-19)13-6-7-14(22-10-13)11-25(15-4-2-1-3-5-15)28-16-8-9-26-12-16/h1-7,10,16-17H,8-9,11-12H2 |
| InChIKey | RJMQZUVWFBVFCQ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 64.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|