C18H16Cl2F2N4S — CID 145239193
3,5-dichloro-N-[[5-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-pyridinyl]methyl]-N-ethylsulfanylaniline (PubChem CID 145239193) has the molecular formula C18H16Cl2F2N4S and a molecular weight of 429.32 g/mol. Its IUPAC name is 3,5-dichloro-N-[[5-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-pyridinyl]methyl]-N-ethylsulfanylaniline.
| Compound Name | 3,5-dichloro-N-[[5-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-pyridinyl]methyl]-N-ethylsulfanylaniline |
|---|---|
| PubChem CID | 145239193 |
| Molecular Formula | C18H16Cl2F2N4S |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 3,5-dichloro-N-[[5-[5-(difluoromethyl)-4H-pyrazol-3-yl]-2-pyridinyl]methyl]-N-ethylsulfanylaniline |
| SMILES | CCSN(Cc1ccc(C2=NN=C(C(F)F)C2)cn1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H16Cl2F2N4S/c1-2-27-26(15-6-12(19)5-13(20)7-15)10-14-4-3-11(9-23-14)16-8-17(18(21)22)25-24-16/h3-7,9,18H,2,8,10H2,1H3 |
| InChIKey | ODEJMLTZUPYRAP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|